C45H53N9O7 — CID 169092596
tert-butyl 3-[3-[1-[1-[6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]hexanoyl]piperidin-4-yl]pyrazol-4-yl]quinoxalin-5-yl]piperidine-1-carboxylate (PubChem CID 169092596) has the molecular formula C45H53N9O7 and a molecular weight of 831.98 g/mol. Its IUPAC name is tert-butyl 3-[3-[1-[1-[6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]hexanoyl]piperidin-4-yl]pyrazol-4-yl]quinoxalin-5-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[3-[1-[1-[6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]hexanoyl]piperidin-4-yl]pyrazol-4-yl]quinoxalin-5-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 169092596 |
| Molecular Formula | C45H53N9O7 |
| Molecular Weight | 831.98 g/mol |
| Exact Mass | 831.41 |
| IUPAC Name | tert-butyl 3-[3-[1-[1-[6-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]hexanoyl]piperidin-4-yl]pyrazol-4-yl]quinoxalin-5-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(c2cccc3ncc(-c4cnn(C5CCN(C(=O)CCCCCNc6ccc7c(c6)C(=O)N(C6CCC(=O)NC6=O)C7=O)CC5)c4)nc23)C1 |
| InChI | InChI=1S/C45H53N9O7/c1-45(2,3)61-44(60)52-20-8-9-28(26-52)32-10-7-11-35-40(32)49-36(25-47-35)29-24-48-53(27-29)31-17-21-51(22-18-31)39(56)12-5-4-6-19-46-30-13-14-33-34(23-30)43(59)54(42(33)58)37-15-16-38(55)50-41(37)57/h7,10-11,13-14,23-25,27-28,31,37,46H,4-6,8-9,12,15-22,26H2,1-3H3,(H,50,55,57) |
| InChIKey | LILDINCQAOAQIB-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 189.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.98 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|