C29H27N7O4 — CID 166994030
2-(2,6-dioxopiperidin-3-yl)-5-[5-(4-quinoxalin-2-ylpyrazol-1-yl)pentylamino]isoindole-1,3-dione (PubChem CID 166994030) has the molecular formula C29H27N7O4 and a molecular weight of 537.58 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[5-(4-quinoxalin-2-ylpyrazol-1-yl)pentylamino]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[5-(4-quinoxalin-2-ylpyrazol-1-yl)pentylamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 166994030 |
| Molecular Formula | C29H27N7O4 |
| Molecular Weight | 537.58 g/mol |
| Exact Mass | 537.21 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[5-(4-quinoxalin-2-ylpyrazol-1-yl)pentylamino]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(NCCCCCn4cc(-c5cnc6ccccc6n5)cn4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C29H27N7O4/c37-26-11-10-25(27(38)34-26)36-28(39)20-9-8-19(14-21(20)29(36)40)30-12-4-1-5-13-35-17-18(15-32-35)24-16-31-22-6-2-3-7-23(22)33-24/h2-3,6-9,14-17,25,30H,1,4-5,10-13H2,(H,34,37,38) |
| InChIKey | YJRLYDUYPJUHHB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 139.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.58 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|