C30H28BrN7O4 — CID 166994089
5-[6-[4-(7-bromoquinoxalin-2-yl)pyrazol-1-yl]hexylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 166994089) has the molecular formula C30H28BrN7O4 and a molecular weight of 630.50 g/mol. Its IUPAC name is 5-[6-[4-(7-bromoquinoxalin-2-yl)pyrazol-1-yl]hexylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[6-[4-(7-bromoquinoxalin-2-yl)pyrazol-1-yl]hexylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 166994089 |
| Molecular Formula | C30H28BrN7O4 |
| Molecular Weight | 630.50 g/mol |
| Exact Mass | 629.14 |
| IUPAC Name | 5-[6-[4-(7-bromoquinoxalin-2-yl)pyrazol-1-yl]hexylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(NCCCCCCn4cc(-c5cnc6ccc(Br)cc6n5)cn4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C30H28BrN7O4/c31-19-5-8-23-24(13-19)35-25(16-33-23)18-15-34-37(17-18)12-4-2-1-3-11-32-20-6-7-21-22(14-20)30(42)38(29(21)41)26-9-10-27(39)36-28(26)40/h5-8,13-17,26,32H,1-4,9-12H2,(H,36,39,40) |
| InChIKey | HDXDJKKRSWOFIQ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 139.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.50 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|