C32H31N7O4 — CID 170548248
2-(2,6-dioxopiperidin-3-yl)-5-[[4-[(4-quinoxalin-2-ylpyrazol-1-yl)methyl]cyclohexyl]methylamino]isoindole-1,3-dione (PubChem CID 170548248) has the molecular formula C32H31N7O4 and a molecular weight of 577.65 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[[4-[(4-quinoxalin-2-ylpyrazol-1-yl)methyl]cyclohexyl]methylamino]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[[4-[(4-quinoxalin-2-ylpyrazol-1-yl)methyl]cyclohexyl]methylamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 170548248 |
| Molecular Formula | C32H31N7O4 |
| Molecular Weight | 577.65 g/mol |
| Exact Mass | 577.24 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[[4-[(4-quinoxalin-2-ylpyrazol-1-yl)methyl]cyclohexyl]methylamino]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(NCC4CCC(Cn5cc(-c6cnc7ccccc7n6)cn5)CC4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C32H31N7O4/c40-29-12-11-28(30(41)37-29)39-31(42)23-10-9-22(13-24(23)32(39)43)33-14-19-5-7-20(8-6-19)17-38-18-21(15-35-38)27-16-34-25-3-1-2-4-26(25)36-27/h1-4,9-10,13,15-16,18-20,28,33H,5-8,11-12,14,17H2,(H,37,40,41) |
| InChIKey | LNTQDDHISLVCFL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 139.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.65 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|