C26H24N6O4 — CID 170548102
2-(2,6-dioxopiperidin-3-yl)-5-[[3-(4-pyridin-2-ylpyrazol-1-yl)cyclobutyl]methylamino]isoindole-1,3-dione (PubChem CID 170548102) has the molecular formula C26H24N6O4 and a molecular weight of 484.52 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[[3-(4-pyridin-2-ylpyrazol-1-yl)cyclobutyl]methylamino]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[[3-(4-pyridin-2-ylpyrazol-1-yl)cyclobutyl]methylamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 170548102 |
| Molecular Formula | C26H24N6O4 |
| Molecular Weight | 484.52 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[[3-(4-pyridin-2-ylpyrazol-1-yl)cyclobutyl]methylamino]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(NCC4CC(n5cc(-c6ccccn6)cn5)C4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C26H24N6O4/c33-23-7-6-22(24(34)30-23)32-25(35)19-5-4-17(11-20(19)26(32)36)28-12-15-9-18(10-15)31-14-16(13-29-31)21-3-1-2-8-27-21/h1-5,8,11,13-15,18,22,28H,6-7,9-10,12H2,(H,30,33,34) |
| InChIKey | FRZJLDQJIDBXHQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 126.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.52 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|