C35H36N8O5 — CID 166993469
2-(2,6-dioxopiperidin-3-yl)-5-[3-[3-[4-(6-morpholin-4-ylquinoxalin-2-yl)pyrazol-1-yl]cyclobutyl]propylamino]isoindole-1,3-dione (PubChem CID 166993469) has the molecular formula C35H36N8O5 and a molecular weight of 648.72 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[3-[3-[4-(6-morpholin-4-ylquinoxalin-2-yl)pyrazol-1-yl]cyclobutyl]propylamino]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[3-[3-[4-(6-morpholin-4-ylquinoxalin-2-yl)pyrazol-1-yl]cyclobutyl]propylamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 166993469 |
| Molecular Formula | C35H36N8O5 |
| Molecular Weight | 648.72 g/mol |
| Exact Mass | 648.28 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[3-[3-[4-(6-morpholin-4-ylquinoxalin-2-yl)pyrazol-1-yl]cyclobutyl]propylamino]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(NCCCC4CC(n5cc(-c6cnc7cc(N8CCOCC8)ccc7n6)cn5)C4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C35H36N8O5/c44-32-8-7-31(33(45)40-32)43-34(46)26-5-3-23(16-27(26)35(43)47)36-9-1-2-21-14-25(15-21)42-20-22(18-38-42)30-19-37-29-17-24(4-6-28(29)39-30)41-10-12-48-13-11-41/h3-6,16-21,25,31,36H,1-2,7-15H2,(H,40,44,45) |
| InChIKey | XXJGHGTYDOAZAT-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 151.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.72 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|