C33H37N7O5 — CID 166994073
2-(2,6-dioxopiperidin-3-yl)-5-[3-[3-[4-[6-(oxan-4-ylamino)-2-pyridinyl]pyrazol-1-yl]cyclobutyl]propylamino]isoindole-1,3-dione (PubChem CID 166994073) has the molecular formula C33H37N7O5 and a molecular weight of 611.70 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[3-[3-[4-[6-(oxan-4-ylamino)-2-pyridinyl]pyrazol-1-yl]cyclobutyl]propylamino]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[3-[3-[4-[6-(oxan-4-ylamino)-2-pyridinyl]pyrazol-1-yl]cyclobutyl]propylamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 166994073 |
| Molecular Formula | C33H37N7O5 |
| Molecular Weight | 611.70 g/mol |
| Exact Mass | 611.29 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[3-[3-[4-[6-(oxan-4-ylamino)-2-pyridinyl]pyrazol-1-yl]cyclobutyl]propylamino]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(NCCCC4CC(n5cc(-c6cccc(NC7CCOCC7)n6)cn5)C4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C33H37N7O5/c41-30-9-8-28(31(42)38-30)40-32(43)25-7-6-23(17-26(25)33(40)44)34-12-2-3-20-15-24(16-20)39-19-21(18-35-39)27-4-1-5-29(37-27)36-22-10-13-45-14-11-22/h1,4-7,17-20,22,24,28,34H,2-3,8-16H2,(H,36,37)(H,38,41,42) |
| InChIKey | JKYFJVDLYFCBKJ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 147.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.70 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|