C38H41N9O4 — CID 170548298
2-(2,6-dioxopiperidin-3-yl)-5-[3-[3-[4-[7-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)quinoxalin-2-yl]pyrazol-1-yl]cyclobutyl]propylamino]isoindole-1,3-dione (PubChem CID 170548298) has the molecular formula C38H41N9O4 and a molecular weight of 687.81 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[3-[3-[4-[7-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)quinoxalin-2-yl]pyrazol-1-yl]cyclobutyl]propylamino]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[3-[3-[4-[7-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)quinoxalin-2-yl]pyrazol-1-yl]cyclobutyl]propylamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 170548298 |
| Molecular Formula | C38H41N9O4 |
| Molecular Weight | 687.81 g/mol |
| Exact Mass | 687.33 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[3-[3-[4-[7-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)quinoxalin-2-yl]pyrazol-1-yl]cyclobutyl]propylamino]isoindole-1,3-dione |
| SMILES | CN1C2CCC1CN(c1ccc3ncc(-c4cnn(C5CC(CCCNc6ccc7c(c6)C(=O)N(C6CCC(=O)NC6=O)C7=O)C5)c4)nc3c1)C2 |
| InChI | InChI=1S/C38H41N9O4/c1-44-26-5-6-27(44)21-45(20-26)25-7-9-31-32(16-25)42-33(18-40-31)23-17-41-46(19-23)28-13-22(14-28)3-2-12-39-24-4-8-29-30(15-24)38(51)47(37(29)50)34-10-11-35(48)43-36(34)49/h4,7-9,15-19,22,26-28,34,39H,2-3,5-6,10-14,20-21H2,1H3,(H,43,48,49) |
| InChIKey | HSQJMOSFQGFCCD-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.81 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|