C29H30N6O4 — CID 170548004
2-(2,6-dioxopiperidin-3-yl)-5-[3-[3-[4-(3-methyl-2-pyridinyl)pyrazol-1-yl]cyclobutyl]propylamino]isoindole-1,3-dione (PubChem CID 170548004) has the molecular formula C29H30N6O4 and a molecular weight of 526.60 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[3-[3-[4-(3-methyl-2-pyridinyl)pyrazol-1-yl]cyclobutyl]propylamino]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[3-[3-[4-(3-methyl-2-pyridinyl)pyrazol-1-yl]cyclobutyl]propylamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 170548004 |
| Molecular Formula | C29H30N6O4 |
| Molecular Weight | 526.60 g/mol |
| Exact Mass | 526.23 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[3-[3-[4-(3-methyl-2-pyridinyl)pyrazol-1-yl]cyclobutyl]propylamino]isoindole-1,3-dione |
| SMILES | Cc1cccnc1-c1cnn(C2CC(CCCNc3ccc4c(c3)C(=O)N(C3CCC(=O)NC3=O)C4=O)C2)c1 |
| InChI | InChI=1S/C29H30N6O4/c1-17-4-2-11-31-26(17)19-15-32-34(16-19)21-12-18(13-21)5-3-10-30-20-6-7-22-23(14-20)29(39)35(28(22)38)24-8-9-25(36)33-27(24)37/h2,4,6-7,11,14-16,18,21,24,30H,3,5,8-10,12-13H2,1H3,(H,33,36,37) |
| InChIKey | SOGXEODCIVJPEB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 126.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.60 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|