C39H42N8O6 — CID 169092401
tert-butyl 3-[3-[1-[3-[3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]propyl]cyclobutyl]pyrazol-4-yl]quinoxalin-6-yl]azetidine-1-carboxylate (PubChem CID 169092401) has the molecular formula C39H42N8O6 and a molecular weight of 718.82 g/mol. Its IUPAC name is tert-butyl 3-[3-[1-[3-[3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]propyl]cyclobutyl]pyrazol-4-yl]quinoxalin-6-yl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[3-[1-[3-[3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]propyl]cyclobutyl]pyrazol-4-yl]quinoxalin-6-yl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 169092401 |
| Molecular Formula | C39H42N8O6 |
| Molecular Weight | 718.82 g/mol |
| Exact Mass | 718.32 |
| IUPAC Name | tert-butyl 3-[3-[1-[3-[3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]propyl]cyclobutyl]pyrazol-4-yl]quinoxalin-6-yl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(c2ccc3ncc(-c4cnn(C5CC(CCCNc6ccc7c(c6)C(=O)N(C6CCC(=O)NC6=O)C7=O)C5)c4)nc3c2)C1 |
| InChI | InChI=1S/C39H42N8O6/c1-39(2,3)53-38(52)45-19-25(20-45)23-6-9-30-31(15-23)43-32(18-41-30)24-17-42-46(21-24)27-13-22(14-27)5-4-12-40-26-7-8-28-29(16-26)37(51)47(36(28)50)33-10-11-34(48)44-35(33)49/h6-9,15-18,21-22,25,27,33,40H,4-5,10-14,19-20H2,1-3H3,(H,44,48,49) |
| InChIKey | JGEDQYYCVGGWLK-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 168.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.82 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|