C32H28N8O4 — CID 166994151
3-[1-[3-[3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]propyl]cyclobutyl]pyrazol-4-yl]quinoxaline-6-carbonitrile (PubChem CID 166994151) has the molecular formula C32H28N8O4 and a molecular weight of 588.63 g/mol. Its IUPAC name is 3-[1-[3-[3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]propyl]cyclobutyl]pyrazol-4-yl]quinoxaline-6-carbonitrile.
| Compound Name | 3-[1-[3-[3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]propyl]cyclobutyl]pyrazol-4-yl]quinoxaline-6-carbonitrile |
|---|---|
| PubChem CID | 166994151 |
| Molecular Formula | C32H28N8O4 |
| Molecular Weight | 588.63 g/mol |
| Exact Mass | 588.22 |
| IUPAC Name | 3-[1-[3-[3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]amino]propyl]cyclobutyl]pyrazol-4-yl]quinoxaline-6-carbonitrile |
| SMILES | N#Cc1ccc2ncc(-c3cnn(C4CC(CCCNc5ccc6c(c5)C(=O)N(C5CCC(=O)NC5=O)C6=O)C4)c3)nc2c1 |
| InChI | InChI=1S/C32H28N8O4/c33-14-19-3-6-25-26(12-19)37-27(16-35-25)20-15-36-39(17-20)22-10-18(11-22)2-1-9-34-21-4-5-23-24(13-21)32(44)40(31(23)43)28-7-8-29(41)38-30(28)42/h3-6,12-13,15-18,22,28,34H,1-2,7-11H2,(H,38,41,42) |
| InChIKey | IDZXGFNXFBWXJY-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 162.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.63 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|