C30H28N8O4 — CID 170548240
2-(2,6-dioxopiperidin-3-yl)-5-[2-[[2-(4-quinoxalin-2-ylpyrazol-1-yl)cyclopropyl]methylamino]ethylamino]isoindole-1,3-dione (PubChem CID 170548240) has the molecular formula C30H28N8O4 and a molecular weight of 564.61 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[2-[[2-(4-quinoxalin-2-ylpyrazol-1-yl)cyclopropyl]methylamino]ethylamino]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[2-[[2-(4-quinoxalin-2-ylpyrazol-1-yl)cyclopropyl]methylamino]ethylamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 170548240 |
| Molecular Formula | C30H28N8O4 |
| Molecular Weight | 564.61 g/mol |
| Exact Mass | 564.22 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[2-[[2-(4-quinoxalin-2-ylpyrazol-1-yl)cyclopropyl]methylamino]ethylamino]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(NCCNCC4CC4n4cc(-c5cnc6ccccc6n5)cn4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C30H28N8O4/c39-27-8-7-25(28(40)36-27)38-29(41)20-6-5-19(12-21(20)30(38)42)32-10-9-31-13-17-11-26(17)37-16-18(14-34-37)24-15-33-22-3-1-2-4-23(22)35-24/h1-6,12,14-17,25-26,31-32H,7-11,13H2,(H,36,39,40) |
| InChIKey | YVIVGWJETQQNBZ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 151.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.61 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|