C34H39N7O4 — CID 170548013
3-[5-[3-[3-[4-[6-(4-methylpiperazin-1-yl)-2-pyridinyl]pyrazol-1-yl]cyclobutyl]propylamino]-1,3-dioxoinden-2-yl]piperidine-2,6-dione (PubChem CID 170548013) has the molecular formula C34H39N7O4 and a molecular weight of 609.73 g/mol. Its IUPAC name is 3-[5-[3-[3-[4-[6-(4-methylpiperazin-1-yl)-2-pyridinyl]pyrazol-1-yl]cyclobutyl]propylamino]-1,3-dioxoinden-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-[3-[3-[4-[6-(4-methylpiperazin-1-yl)-2-pyridinyl]pyrazol-1-yl]cyclobutyl]propylamino]-1,3-dioxoinden-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170548013 |
| Molecular Formula | C34H39N7O4 |
| Molecular Weight | 609.73 g/mol |
| Exact Mass | 609.31 |
| IUPAC Name | 3-[5-[3-[3-[4-[6-(4-methylpiperazin-1-yl)-2-pyridinyl]pyrazol-1-yl]cyclobutyl]propylamino]-1,3-dioxoinden-2-yl]piperidine-2,6-dione |
| SMILES | CN1CCN(c2cccc(-c3cnn(C4CC(CCCNc5ccc6c(c5)C(=O)C(C5CCC(=O)NC5=O)C6=O)C4)c3)n2)CC1 |
| InChI | InChI=1S/C34H39N7O4/c1-39-12-14-40(15-13-39)29-6-2-5-28(37-29)22-19-36-41(20-22)24-16-21(17-24)4-3-11-35-23-7-8-25-27(18-23)33(44)31(32(25)43)26-9-10-30(42)38-34(26)45/h2,5-8,18-21,24,26,31,35H,3-4,9-17H2,1H3,(H,38,42,45) |
| InChIKey | WFNUHGQHDBWQSW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 129.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.73 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|