C33H29F3N6O4 — CID 166994419
3-[1,3-dioxo-5-[3-[3-[4-quinoxalin-2-yl-3-(trifluoromethyl)pyrazol-1-yl]cyclobutyl]propylamino]inden-2-yl]piperidine-2,6-dione (PubChem CID 166994419) has the molecular formula C33H29F3N6O4 and a molecular weight of 630.63 g/mol. Its IUPAC name is 3-[1,3-dioxo-5-[3-[3-[4-quinoxalin-2-yl-3-(trifluoromethyl)pyrazol-1-yl]cyclobutyl]propylamino]inden-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[1,3-dioxo-5-[3-[3-[4-quinoxalin-2-yl-3-(trifluoromethyl)pyrazol-1-yl]cyclobutyl]propylamino]inden-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166994419 |
| Molecular Formula | C33H29F3N6O4 |
| Molecular Weight | 630.63 g/mol |
| Exact Mass | 630.22 |
| IUPAC Name | 3-[1,3-dioxo-5-[3-[3-[4-quinoxalin-2-yl-3-(trifluoromethyl)pyrazol-1-yl]cyclobutyl]propylamino]inden-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(C2C(=O)c3ccc(NCCCC4CC(n5cc(-c6cnc7ccccc7n6)c(C(F)(F)F)n5)C4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C33H29F3N6O4/c34-33(35,36)31-23(26-15-38-24-5-1-2-6-25(24)39-26)16-42(41-31)19-12-17(13-19)4-3-11-37-18-7-8-20-22(14-18)30(45)28(29(20)44)21-9-10-27(43)40-32(21)46/h1-2,5-8,14-17,19,21,28,37H,3-4,9-13H2,(H,40,43,46) |
| InChIKey | QAJPBTRCJZOIHH-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 135.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.63 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|