C33H33N7O4 — CID 170548218
2-(1-methyl-2,6-dioxopiperidin-3-yl)-5-[3-[3-(3-methyl-4-quinoxalin-2-ylpyrazol-1-yl)cyclobutyl]propylamino]isoindole-1,3-dione (PubChem CID 170548218) has the molecular formula C33H33N7O4 and a molecular weight of 591.67 g/mol. Its IUPAC name is 2-(1-methyl-2,6-dioxopiperidin-3-yl)-5-[3-[3-(3-methyl-4-quinoxalin-2-ylpyrazol-1-yl)cyclobutyl]propylamino]isoindole-1,3-dione.
| Compound Name | 2-(1-methyl-2,6-dioxopiperidin-3-yl)-5-[3-[3-(3-methyl-4-quinoxalin-2-ylpyrazol-1-yl)cyclobutyl]propylamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 170548218 |
| Molecular Formula | C33H33N7O4 |
| Molecular Weight | 591.67 g/mol |
| Exact Mass | 591.26 |
| IUPAC Name | 2-(1-methyl-2,6-dioxopiperidin-3-yl)-5-[3-[3-(3-methyl-4-quinoxalin-2-ylpyrazol-1-yl)cyclobutyl]propylamino]isoindole-1,3-dione |
| SMILES | Cc1nn(C2CC(CCCNc3ccc4c(c3)C(=O)N(C3CCC(=O)N(C)C3=O)C4=O)C2)cc1-c1cnc2ccccc2n1 |
| InChI | InChI=1S/C33H33N7O4/c1-19-25(28-17-35-26-7-3-4-8-27(26)36-28)18-39(37-19)22-14-20(15-22)6-5-13-34-21-9-10-23-24(16-21)32(43)40(31(23)42)29-11-12-30(41)38(2)33(29)44/h3-4,7-10,16-18,20,22,29,34H,5-6,11-15H2,1-2H3 |
| InChIKey | DCMIQUKESOHDFK-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.67 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|