C39H42N8O5 — CID 170548244
5-[3-[3-[3-cyclopropyl-4-[7-(morpholin-4-ylmethyl)quinoxalin-2-yl]pyrazol-1-yl]cyclobutyl]propylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 170548244) has the molecular formula C39H42N8O5 and a molecular weight of 702.82 g/mol. Its IUPAC name is 5-[3-[3-[3-cyclopropyl-4-[7-(morpholin-4-ylmethyl)quinoxalin-2-yl]pyrazol-1-yl]cyclobutyl]propylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[3-[3-[3-cyclopropyl-4-[7-(morpholin-4-ylmethyl)quinoxalin-2-yl]pyrazol-1-yl]cyclobutyl]propylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 170548244 |
| Molecular Formula | C39H42N8O5 |
| Molecular Weight | 702.82 g/mol |
| Exact Mass | 702.33 |
| IUPAC Name | 5-[3-[3-[3-cyclopropyl-4-[7-(morpholin-4-ylmethyl)quinoxalin-2-yl]pyrazol-1-yl]cyclobutyl]propylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(NCCCC4CC(n5cc(-c6cnc7ccc(CN8CCOCC8)cc7n6)c(C6CC6)n5)C4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C39H42N8O5/c48-35-10-9-34(37(49)43-35)47-38(50)28-7-6-26(19-29(28)39(47)51)40-11-1-2-23-16-27(17-23)46-22-30(36(44-46)25-4-5-25)33-20-41-31-8-3-24(18-32(31)42-33)21-45-12-14-52-15-13-45/h3,6-8,18-20,22-23,25,27,34,40H,1-2,4-5,9-17,21H2,(H,43,48,49) |
| InChIKey | CKVQFEVBLRTHSX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 151.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.82 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|