C33H30N6O4 — CID 175951068
4-[2-[3-(3-cyclopropyl-4-quinoxalin-2-ylpyrazol-1-yl)cyclobutyl]ethyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 175951068) has the molecular formula C33H30N6O4 and a molecular weight of 574.64 g/mol. Its IUPAC name is 4-[2-[3-(3-cyclopropyl-4-quinoxalin-2-ylpyrazol-1-yl)cyclobutyl]ethyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[2-[3-(3-cyclopropyl-4-quinoxalin-2-ylpyrazol-1-yl)cyclobutyl]ethyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 175951068 |
| Molecular Formula | C33H30N6O4 |
| Molecular Weight | 574.64 g/mol |
| Exact Mass | 574.23 |
| IUPAC Name | 4-[2-[3-(3-cyclopropyl-4-quinoxalin-2-ylpyrazol-1-yl)cyclobutyl]ethyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(CCC4CC(n5cc(-c6cnc7ccccc7n6)c(C6CC6)n5)C4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C33H30N6O4/c40-28-13-12-27(31(41)36-28)39-32(42)22-5-3-4-19(29(22)33(39)43)9-8-18-14-21(15-18)38-17-23(30(37-38)20-10-11-20)26-16-34-24-6-1-2-7-25(24)35-26/h1-7,16-18,20-21,27H,8-15H2,(H,36,40,41) |
| InChIKey | ZTXHPLMDMOLZPW-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 127.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.64 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|