C31H31N7O4 — CID 166994430
2-(2,6-dioxopiperidin-3-yl)-4-[3-[3-(4-quinoxalin-2-yl-3,4-dihydropyrazol-2-yl)cyclobutyl]propylamino]isoindole-1,3-dione (PubChem CID 166994430) has the molecular formula C31H31N7O4 and a molecular weight of 565.63 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-[3-[3-(4-quinoxalin-2-yl-3,4-dihydropyrazol-2-yl)cyclobutyl]propylamino]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-[3-[3-(4-quinoxalin-2-yl-3,4-dihydropyrazol-2-yl)cyclobutyl]propylamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 166994430 |
| Molecular Formula | C31H31N7O4 |
| Molecular Weight | 565.63 g/mol |
| Exact Mass | 565.24 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-[3-[3-(4-quinoxalin-2-yl-3,4-dihydropyrazol-2-yl)cyclobutyl]propylamino]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(NCCCC4CC(N5CC(c6cnc7ccccc7n6)C=N5)C4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C31H31N7O4/c39-27-11-10-26(29(40)36-27)38-30(41)21-6-3-9-24(28(21)31(38)42)32-12-4-5-18-13-20(14-18)37-17-19(15-34-37)25-16-33-22-7-1-2-8-23(22)35-25/h1-3,6-9,15-16,18-20,26,32H,4-5,10-14,17H2,(H,36,39,40) |
| InChIKey | MVBMWYWZPSYLHN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 136.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.63 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|