C26H34N4O5 — CID 176664105
2-(2,6-dioxopiperidin-3-yl)-4-[3-[3-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-2-yl)propoxy]propylamino]isoindole-1,3-dione (PubChem CID 176664105) has the molecular formula C26H34N4O5 and a molecular weight of 482.58 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-[3-[3-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-2-yl)propoxy]propylamino]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-[3-[3-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-2-yl)propoxy]propylamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 176664105 |
| Molecular Formula | C26H34N4O5 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-[3-[3-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-2-yl)propoxy]propylamino]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(NCCCOCCCC4CC5CCCN5C4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C26H34N4O5/c31-22-10-9-21(24(32)28-22)30-25(33)19-7-1-8-20(23(19)26(30)34)27-11-4-14-35-13-3-5-17-15-18-6-2-12-29(18)16-17/h1,7-8,17-18,21,27H,2-6,9-16H2,(H,28,31,32) |
| InChIKey | YNCFJGHHGCSGKS-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|