C27H26N6O4 — CID 170548065
5-[[3-(3-cyclopropylpyrazolo[3,4-b]pyridin-1-yl)cyclobutyl]methylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 170548065) has the molecular formula C27H26N6O4 and a molecular weight of 498.54 g/mol. Its IUPAC name is 5-[[3-(3-cyclopropylpyrazolo[3,4-b]pyridin-1-yl)cyclobutyl]methylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[[3-(3-cyclopropylpyrazolo[3,4-b]pyridin-1-yl)cyclobutyl]methylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 170548065 |
| Molecular Formula | C27H26N6O4 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | 5-[[3-(3-cyclopropylpyrazolo[3,4-b]pyridin-1-yl)cyclobutyl]methylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(NCC4CC(n5nc(C6CC6)c6cccnc65)C4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C27H26N6O4/c34-22-8-7-21(25(35)30-22)32-26(36)18-6-5-16(12-20(18)27(32)37)29-13-14-10-17(11-14)33-24-19(2-1-9-28-24)23(31-33)15-3-4-15/h1-2,5-6,9,12,14-15,17,21,29H,3-4,7-8,10-11,13H2,(H,30,34,35) |
| InChIKey | YJVYDGPBOFULMH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 126.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|