C28H27N5O4 — CID 166993610
5-[[3-(3-cyclopropylindazol-1-yl)cyclobutyl]methylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 166993610) has the molecular formula C28H27N5O4 and a molecular weight of 497.56 g/mol. Its IUPAC name is 5-[[3-(3-cyclopropylindazol-1-yl)cyclobutyl]methylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[[3-(3-cyclopropylindazol-1-yl)cyclobutyl]methylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 166993610 |
| Molecular Formula | C28H27N5O4 |
| Molecular Weight | 497.56 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | 5-[[3-(3-cyclopropylindazol-1-yl)cyclobutyl]methylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(NCC4CC(n5nc(C6CC6)c6ccccc65)C4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C28H27N5O4/c34-24-10-9-23(26(35)30-24)32-27(36)19-8-7-17(13-21(19)28(32)37)29-14-15-11-18(12-15)33-22-4-2-1-3-20(22)25(31-33)16-5-6-16/h1-4,7-8,13,15-16,18,23,29H,5-6,9-12,14H2,(H,30,34,35) |
| InChIKey | IILXZGYRDBIOTJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.56 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|