C36H37N7O5 — CID 166994659
2-(2,6-dioxopiperidin-3-yl)-5-[[6-oxo-6-[4-(4-quinolin-2-ylpyrazol-1-yl)piperidin-1-yl]hexyl]amino]isoindole-1,3-dione (PubChem CID 166994659) has the molecular formula C36H37N7O5 and a molecular weight of 647.74 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[[6-oxo-6-[4-(4-quinolin-2-ylpyrazol-1-yl)piperidin-1-yl]hexyl]amino]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[[6-oxo-6-[4-(4-quinolin-2-ylpyrazol-1-yl)piperidin-1-yl]hexyl]amino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 166994659 |
| Molecular Formula | C36H37N7O5 |
| Molecular Weight | 647.74 g/mol |
| Exact Mass | 647.29 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[[6-oxo-6-[4-(4-quinolin-2-ylpyrazol-1-yl)piperidin-1-yl]hexyl]amino]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(NCCCCCC(=O)N4CCC(n5cc(-c6ccc7ccccc7n6)cn5)CC4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C36H37N7O5/c44-32-14-13-31(34(46)40-32)43-35(47)27-11-10-25(20-28(27)36(43)48)37-17-5-1-2-8-33(45)41-18-15-26(16-19-41)42-22-24(21-38-42)30-12-9-23-6-3-4-7-29(23)39-30/h3-4,6-7,9-12,20-22,26,31,37H,1-2,5,8,13-19H2,(H,40,44,46) |
| InChIKey | SYTKFZUASBFTON-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 146.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.74 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|