C30H33ClN4O5 — CID 166993602
5-[[6-[4-(4-chlorophenyl)piperidin-1-yl]-6-oxohexyl]amino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 166993602) has the molecular formula C30H33ClN4O5 and a molecular weight of 565.07 g/mol. Its IUPAC name is 5-[[6-[4-(4-chlorophenyl)piperidin-1-yl]-6-oxohexyl]amino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[[6-[4-(4-chlorophenyl)piperidin-1-yl]-6-oxohexyl]amino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 166993602 |
| Molecular Formula | C30H33ClN4O5 |
| Molecular Weight | 565.07 g/mol |
| Exact Mass | 564.21 |
| IUPAC Name | 5-[[6-[4-(4-chlorophenyl)piperidin-1-yl]-6-oxohexyl]amino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(NCCCCCC(=O)N4CCC(c5ccc(Cl)cc5)CC4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C30H33ClN4O5/c31-21-7-5-19(6-8-21)20-13-16-34(17-14-20)27(37)4-2-1-3-15-32-22-9-10-23-24(18-22)30(40)35(29(23)39)25-11-12-26(36)33-28(25)38/h5-10,18,20,25,32H,1-4,11-17H2,(H,33,36,38) |
| InChIKey | OQSMNKJYUSMFKZ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.07 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|