C30H35ClN4O5 — CID 166993431
5-[[6-[4-(2-chlorophenyl)piperidin-1-yl]-6-oxohexyl]amino]-2-(2-hydroxy-6-oxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 166993431) has the molecular formula C30H35ClN4O5 and a molecular weight of 567.09 g/mol. Its IUPAC name is 5-[[6-[4-(2-chlorophenyl)piperidin-1-yl]-6-oxohexyl]amino]-2-(2-hydroxy-6-oxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[[6-[4-(2-chlorophenyl)piperidin-1-yl]-6-oxohexyl]amino]-2-(2-hydroxy-6-oxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 166993431 |
| Molecular Formula | C30H35ClN4O5 |
| Molecular Weight | 567.09 g/mol |
| Exact Mass | 566.23 |
| IUPAC Name | 5-[[6-[4-(2-chlorophenyl)piperidin-1-yl]-6-oxohexyl]amino]-2-(2-hydroxy-6-oxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(NCCCCCC(=O)N4CCC(c5ccccc5Cl)CC4)cc3C2=O)C(O)N1 |
| InChI | InChI=1S/C30H35ClN4O5/c31-24-7-4-3-6-21(24)19-13-16-34(17-14-19)27(37)8-2-1-5-15-32-20-9-10-22-23(18-20)30(40)35(29(22)39)25-11-12-26(36)33-28(25)38/h3-4,6-7,9-10,18-19,25,28,32,38H,1-2,5,8,11-17H2,(H,33,36) |
| InChIKey | VGQYGXUBMUFPFV-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.09 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|