C32H41N7O5 — CID 166993567
2-(2,6-dioxopiperidin-3-yl)-5-[[6-oxo-6-[4-(4-piperidin-1-ylpyrazol-1-yl)piperidin-1-yl]hexyl]amino]isoindole-1,3-dione (PubChem CID 166993567) has the molecular formula C32H41N7O5 and a molecular weight of 603.72 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[[6-oxo-6-[4-(4-piperidin-1-ylpyrazol-1-yl)piperidin-1-yl]hexyl]amino]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[[6-oxo-6-[4-(4-piperidin-1-ylpyrazol-1-yl)piperidin-1-yl]hexyl]amino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 166993567 |
| Molecular Formula | C32H41N7O5 |
| Molecular Weight | 603.72 g/mol |
| Exact Mass | 603.32 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[[6-oxo-6-[4-(4-piperidin-1-ylpyrazol-1-yl)piperidin-1-yl]hexyl]amino]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(NCCCCCC(=O)N4CCC(n5cc(N6CCCCC6)cn5)CC4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C32H41N7O5/c40-28-11-10-27(30(42)35-28)39-31(43)25-9-8-22(19-26(25)32(39)44)33-14-4-1-3-7-29(41)37-17-12-23(13-18-37)38-21-24(20-34-38)36-15-5-2-6-16-36/h8-9,19-21,23,27,33H,1-7,10-18H2,(H,35,40,42) |
| InChIKey | LBZHMCOZDQNWAY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 136.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.72 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|