C22H22N6 — CID 166992967
3-[4-(4-quinoxalin-2-ylpyrazol-1-yl)piperidin-1-yl]aniline (PubChem CID 166992967) has the molecular formula C22H22N6 and a molecular weight of 370.46 g/mol. Its IUPAC name is 3-[4-(4-quinoxalin-2-ylpyrazol-1-yl)piperidin-1-yl]aniline.
| Compound Name | 3-[4-(4-quinoxalin-2-ylpyrazol-1-yl)piperidin-1-yl]aniline |
|---|---|
| PubChem CID | 166992967 |
| Molecular Formula | C22H22N6 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 3-[4-(4-quinoxalin-2-ylpyrazol-1-yl)piperidin-1-yl]aniline |
| SMILES | Nc1cccc(N2CCC(n3cc(-c4cnc5ccccc5n4)cn3)CC2)c1 |
| InChI | InChI=1S/C22H22N6/c23-17-4-3-5-19(12-17)27-10-8-18(9-11-27)28-15-16(13-25-28)22-14-24-20-6-1-2-7-21(20)26-22/h1-7,12-15,18H,8-11,23H2 |
| InChIKey | FUOJEGDTCWPBNT-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|