C30H41N5O4 — CID 161029585
tert-butyl 3-[[4-[3-(1-methylbenzimidazol-2-yl)phenyl]piperazin-1-yl]methyl]piperidine-1-carboxylate;formic acid (PubChem CID 161029585) has the molecular formula C30H41N5O4 and a molecular weight of 535.69 g/mol. Its IUPAC name is tert-butyl 3-[[4-[3-(1-methylbenzimidazol-2-yl)phenyl]piperazin-1-yl]methyl]piperidine-1-carboxylate;formic acid.
| Compound Name | tert-butyl 3-[[4-[3-(1-methylbenzimidazol-2-yl)phenyl]piperazin-1-yl]methyl]piperidine-1-carboxylate;formic acid |
|---|---|
| PubChem CID | 161029585 |
| Molecular Formula | C30H41N5O4 |
| Molecular Weight | 535.69 g/mol |
| Exact Mass | 535.32 |
| IUPAC Name | tert-butyl 3-[[4-[3-(1-methylbenzimidazol-2-yl)phenyl]piperazin-1-yl]methyl]piperidine-1-carboxylate;formic acid |
| SMILES | Cn1c(-c2cccc(N3CCN(CC4CCCN(C(=O)OC(C)(C)C)C4)CC3)c2)nc2ccccc21.O=CO |
| InChI | InChI=1S/C29H39N5O2.CH2O2/c1-29(2,3)36-28(35)34-14-8-9-22(21-34)20-32-15-17-33(18-16-32)24-11-7-10-23(19-24)27-30-25-12-5-6-13-26(25)31(27)4;2-1-3/h5-7,10-13,19,22H,8-9,14-18,20-21H2,1-4H3;1H,(H,2,3) |
| InChIKey | TZKSWBRCMCVWLP-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.69 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|