C24H29N5O — CID 67099362
[(3R)-1-[3-(1-methylbenzimidazol-2-yl)phenyl]piperidin-3-yl]-piperazin-1-ylmethanone (PubChem CID 67099362) has the molecular formula C24H29N5O and a molecular weight of 403.53 g/mol. Its IUPAC name is [(3R)-1-[3-(1-methylbenzimidazol-2-yl)phenyl]piperidin-3-yl]-piperazin-1-ylmethanone.
| Compound Name | [(3R)-1-[3-(1-methylbenzimidazol-2-yl)phenyl]piperidin-3-yl]-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 67099362 |
| Molecular Formula | C24H29N5O |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | [(3R)-1-[3-(1-methylbenzimidazol-2-yl)phenyl]piperidin-3-yl]-piperazin-1-ylmethanone |
| SMILES | Cn1c(-c2cccc(N3CCC[C@@H](C(=O)N4CCNCC4)C3)c2)nc2ccccc21 |
| InChI | InChI=1S/C24H29N5O/c1-27-22-10-3-2-9-21(22)26-23(27)18-6-4-8-20(16-18)29-13-5-7-19(17-29)24(30)28-14-11-25-12-15-28/h2-4,6,8-10,16,19,25H,5,7,11-15,17H2,1H3/t19-/m1/s1 |
| InChIKey | LUUDFKBITBVURY-LJQANCHMSA-N |
| XLogP | 2.89 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |