C27H35N5O3 — CID 159968849
[3-(dimethylamino)pyrrolidin-1-yl]-[(3R)-1-[3-(1-methylbenzimidazol-2-yl)phenyl]piperidin-3-yl]methanone;formic acid (PubChem CID 159968849) has the molecular formula C27H35N5O3 and a molecular weight of 477.61 g/mol. Its IUPAC name is [3-(dimethylamino)pyrrolidin-1-yl]-[(3R)-1-[3-(1-methylbenzimidazol-2-yl)phenyl]piperidin-3-yl]methanone;formic acid.
| Compound Name | [3-(dimethylamino)pyrrolidin-1-yl]-[(3R)-1-[3-(1-methylbenzimidazol-2-yl)phenyl]piperidin-3-yl]methanone;formic acid |
|---|---|
| PubChem CID | 159968849 |
| Molecular Formula | C27H35N5O3 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.27 |
| IUPAC Name | [3-(dimethylamino)pyrrolidin-1-yl]-[(3R)-1-[3-(1-methylbenzimidazol-2-yl)phenyl]piperidin-3-yl]methanone;formic acid |
| SMILES | CN(C)C1CCN(C(=O)[C@@H]2CCCN(c3cccc(-c4nc5ccccc5n4C)c3)C2)C1.O=CO |
| InChI | InChI=1S/C26H33N5O.CH2O2/c1-28(2)22-13-15-31(18-22)26(32)20-9-7-14-30(17-20)21-10-6-8-19(16-21)25-27-23-11-4-5-12-24(23)29(25)3;2-1-3/h4-6,8,10-12,16,20,22H,7,9,13-15,17-18H2,1-3H3;1H,(H,2,3)/t20-,22?;/m1./s1 |
| InChIKey | OEGVNILGQTYZAS-DWUQZJAVSA-N |
| XLogP | 3.32 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|