C20H33NO3Si — CID 23731089
2-[(3S,3aS,6aR)-6a-methyl-6-phenyl-3,3a,4,5-tetrahydrodioxolo[3,4-b]pyrrol-3-yl]ethoxy-tert-butyl-dimethylsilane (PubChem CID 23731089) has the molecular formula C20H33NO3Si and a molecular weight of 363.57 g/mol. Its IUPAC name is 2-[(3S,3aS,6aR)-6a-methyl-6-phenyl-3,3a,4,5-tetrahydrodioxolo[3,4-b]pyrrol-3-yl]ethoxy-tert-butyl-dimethylsilane.
| Compound Name | 2-[(3S,3aS,6aR)-6a-methyl-6-phenyl-3,3a,4,5-tetrahydrodioxolo[3,4-b]pyrrol-3-yl]ethoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 23731089 |
| Molecular Formula | C20H33NO3Si |
| Molecular Weight | 363.57 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | 2-[(3S,3aS,6aR)-6a-methyl-6-phenyl-3,3a,4,5-tetrahydrodioxolo[3,4-b]pyrrol-3-yl]ethoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCC[C@@H]1OO[C@]2(C)[C@H]1CCN2c1ccccc1 |
| InChI | InChI=1S/C20H33NO3Si/c1-19(2,3)25(5,6)22-15-13-18-17-12-14-21(20(17,4)24-23-18)16-10-8-7-9-11-16/h7-11,17-18H,12-15H2,1-6H3/t17-,18-,20+/m0/s1 |
| InChIKey | PDZVWPRHUZYHSL-CMKODMSKSA-N |
| XLogP | 4.97 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.57 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|