C26H36ClFN4O3Si — CID 171060941
N-[[3-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]piperazin-1-yl]phenyl]carbamoyl]-4-chloro-2-fluorobenzamide (PubChem CID 171060941) has the molecular formula C26H36ClFN4O3Si and a molecular weight of 535.14 g/mol. Its IUPAC name is N-[[3-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]piperazin-1-yl]phenyl]carbamoyl]-4-chloro-2-fluorobenzamide.
| Compound Name | N-[[3-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]piperazin-1-yl]phenyl]carbamoyl]-4-chloro-2-fluorobenzamide |
|---|---|
| PubChem CID | 171060941 |
| Molecular Formula | C26H36ClFN4O3Si |
| Molecular Weight | 535.14 g/mol |
| Exact Mass | 534.22 |
| IUPAC Name | N-[[3-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]piperazin-1-yl]phenyl]carbamoyl]-4-chloro-2-fluorobenzamide |
| SMILES | CC(C)(C)[Si](C)(C)OCCN1CCN(c2cccc(NC(=O)NC(=O)c3ccc(Cl)cc3F)c2)CC1 |
| InChI | InChI=1S/C26H36ClFN4O3Si/c1-26(2,3)36(4,5)35-16-15-31-11-13-32(14-12-31)21-8-6-7-20(18-21)29-25(34)30-24(33)22-10-9-19(27)17-23(22)28/h6-10,17-18H,11-16H2,1-5H3,(H2,29,30,33,34) |
| InChIKey | KUMUDHFRKRMQSV-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.14 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|