C24H25ClFN7O — CID 135771533
1-(3-chlorophenyl)-3-[(Z)-N-(4,6-dimethylpyrimidin-2-yl)-C-[4-(4-fluorophenyl)piperazin-1-yl]carbonimidoyl]urea (PubChem CID 135771533) has the molecular formula C24H25ClFN7O and a molecular weight of 481.96 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[(Z)-N-(4,6-dimethylpyrimidin-2-yl)-C-[4-(4-fluorophenyl)piperazin-1-yl]carbonimidoyl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[(Z)-N-(4,6-dimethylpyrimidin-2-yl)-C-[4-(4-fluorophenyl)piperazin-1-yl]carbonimidoyl]urea |
|---|---|
| PubChem CID | 135771533 |
| Molecular Formula | C24H25ClFN7O |
| Molecular Weight | 481.96 g/mol |
| Exact Mass | 481.18 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[(Z)-N-(4,6-dimethylpyrimidin-2-yl)-C-[4-(4-fluorophenyl)piperazin-1-yl]carbonimidoyl]urea |
| SMILES | Cc1cc(C)nc(/N=C(/NC(=O)Nc2cccc(Cl)c2)N2CCN(c3ccc(F)cc3)CC2)n1 |
| InChI | InChI=1S/C24H25ClFN7O/c1-16-14-17(2)28-22(27-16)30-23(31-24(34)29-20-5-3-4-18(25)15-20)33-12-10-32(11-13-33)21-8-6-19(26)7-9-21/h3-9,14-15H,10-13H2,1-2H3,(H2,27,28,29,30,31,34) |
| InChIKey | GHAXNTMJXVAAFP-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.96 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|