C25H26Cl3N7O — CID 135609992
1-[(E)-C-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-N-(4,6-dimethylpyrimidin-2-yl)carbonimidoyl]-3-(3,4-dichlorophenyl)urea (PubChem CID 135609992) has the molecular formula C25H26Cl3N7O and a molecular weight of 546.89 g/mol. Its IUPAC name is 1-[(E)-C-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-N-(4,6-dimethylpyrimidin-2-yl)carbonimidoyl]-3-(3,4-dichlorophenyl)urea.
| Compound Name | 1-[(E)-C-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-N-(4,6-dimethylpyrimidin-2-yl)carbonimidoyl]-3-(3,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 135609992 |
| Molecular Formula | C25H26Cl3N7O |
| Molecular Weight | 546.89 g/mol |
| Exact Mass | 545.13 |
| IUPAC Name | 1-[(E)-C-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-N-(4,6-dimethylpyrimidin-2-yl)carbonimidoyl]-3-(3,4-dichlorophenyl)urea |
| SMILES | Cc1cc(C)nc(/N=C(\NC(=O)Nc2ccc(Cl)c(Cl)c2)N2CCN(c3cc(Cl)ccc3C)CC2)n1 |
| InChI | InChI=1S/C25H26Cl3N7O/c1-15-4-5-18(26)13-22(15)34-8-10-35(11-9-34)24(32-23-29-16(2)12-17(3)30-23)33-25(36)31-19-6-7-20(27)21(28)14-19/h4-7,12-14H,8-11H2,1-3H3,(H2,29,30,31,32,33,36) |
| InChIKey | GMFPNYCXHAWYEV-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.89 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|