C19H24N6O2 — CID 135771520
1-[(Z)-N-(4,6-dimethylpyrimidin-2-yl)-C-morpholin-4-ylcarbonimidoyl]-3-(4-methylphenyl)urea (PubChem CID 135771520) has the molecular formula C19H24N6O2 and a molecular weight of 368.44 g/mol. Its IUPAC name is 1-[(Z)-N-(4,6-dimethylpyrimidin-2-yl)-C-morpholin-4-ylcarbonimidoyl]-3-(4-methylphenyl)urea.
| Compound Name | 1-[(Z)-N-(4,6-dimethylpyrimidin-2-yl)-C-morpholin-4-ylcarbonimidoyl]-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 135771520 |
| Molecular Formula | C19H24N6O2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 1-[(Z)-N-(4,6-dimethylpyrimidin-2-yl)-C-morpholin-4-ylcarbonimidoyl]-3-(4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)N/C(=N/c2nc(C)cc(C)n2)N2CCOCC2)cc1 |
| InChI | InChI=1S/C19H24N6O2/c1-13-4-6-16(7-5-13)22-19(26)24-18(25-8-10-27-11-9-25)23-17-20-14(2)12-15(3)21-17/h4-7,12H,8-11H2,1-3H3,(H2,20,21,22,23,24,26) |
| InChIKey | WCDHGZYLFSNGFU-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|