C21H27N7O4S — CID 135687846
1-[(Z)-N'-(4,6-dimethylpyrimidin-2-yl)-N-[(4-methylphenyl)sulfonylcarbamoyl]carbamimidoyl]piperidine-4-carboxamide (PubChem CID 135687846) has the molecular formula C21H27N7O4S and a molecular weight of 473.56 g/mol. Its IUPAC name is 1-[(Z)-N'-(4,6-dimethylpyrimidin-2-yl)-N-[(4-methylphenyl)sulfonylcarbamoyl]carbamimidoyl]piperidine-4-carboxamide.
| Compound Name | 1-[(Z)-N'-(4,6-dimethylpyrimidin-2-yl)-N-[(4-methylphenyl)sulfonylcarbamoyl]carbamimidoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 135687846 |
| Molecular Formula | C21H27N7O4S |
| Molecular Weight | 473.56 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | 1-[(Z)-N'-(4,6-dimethylpyrimidin-2-yl)-N-[(4-methylphenyl)sulfonylcarbamoyl]carbamimidoyl]piperidine-4-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)N/C(=N/c2nc(C)cc(C)n2)N2CCC(C(N)=O)CC2)cc1 |
| InChI | InChI=1S/C21H27N7O4S/c1-13-4-6-17(7-5-13)33(31,32)27-21(30)26-20(25-19-23-14(2)12-15(3)24-19)28-10-8-16(9-11-28)18(22)29/h4-7,12,16H,8-11H2,1-3H3,(H2,22,29)(H2,23,24,25,26,27,30) |
| InChIKey | XOFMNTRPSLTHTK-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 159.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.56 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|