C24H27N7O3 — CID 135771540
1-[(Z)-N-(4,6-dimethylpyrimidin-2-yl)-C-[4-(furan-2-carbonyl)piperazin-1-yl]carbonimidoyl]-3-(4-methylphenyl)urea (PubChem CID 135771540) has the molecular formula C24H27N7O3 and a molecular weight of 461.53 g/mol. Its IUPAC name is 1-[(Z)-N-(4,6-dimethylpyrimidin-2-yl)-C-[4-(furan-2-carbonyl)piperazin-1-yl]carbonimidoyl]-3-(4-methylphenyl)urea.
| Compound Name | 1-[(Z)-N-(4,6-dimethylpyrimidin-2-yl)-C-[4-(furan-2-carbonyl)piperazin-1-yl]carbonimidoyl]-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 135771540 |
| Molecular Formula | C24H27N7O3 |
| Molecular Weight | 461.53 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | 1-[(Z)-N-(4,6-dimethylpyrimidin-2-yl)-C-[4-(furan-2-carbonyl)piperazin-1-yl]carbonimidoyl]-3-(4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)N/C(=N/c2nc(C)cc(C)n2)N2CCN(C(=O)c3ccco3)CC2)cc1 |
| InChI | InChI=1S/C24H27N7O3/c1-16-6-8-19(9-7-16)27-24(33)29-23(28-22-25-17(2)15-18(3)26-22)31-12-10-30(11-13-31)21(32)20-5-4-14-34-20/h4-9,14-15H,10-13H2,1-3H3,(H2,25,26,27,28,29,33) |
| InChIKey | GTBHIGOEGQOCEA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 115.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.53 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|