C25H27N7O3S — CID 17090941
(3Z)-1-(4-acetylphenyl)-3-[[(4,6-dimethylpyrimidin-2-yl)amino]-[4-(furan-2-carbonyl)piperazin-1-yl]methylidene]thiourea (PubChem CID 17090941) has the molecular formula C25H27N7O3S and a molecular weight of 505.60 g/mol. Its IUPAC name is (3Z)-1-(4-acetylphenyl)-3-[[(4,6-dimethylpyrimidin-2-yl)amino]-[4-(furan-2-carbonyl)piperazin-1-yl]methylidene]thiourea.
| Compound Name | (3Z)-1-(4-acetylphenyl)-3-[[(4,6-dimethylpyrimidin-2-yl)amino]-[4-(furan-2-carbonyl)piperazin-1-yl]methylidene]thiourea |
|---|---|
| PubChem CID | 17090941 |
| Molecular Formula | C25H27N7O3S |
| Molecular Weight | 505.60 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | (3Z)-1-(4-acetylphenyl)-3-[[(4,6-dimethylpyrimidin-2-yl)amino]-[4-(furan-2-carbonyl)piperazin-1-yl]methylidene]thiourea |
| SMILES | CC(=O)c1ccc(NC(=S)/N=C(/Nc2nc(C)cc(C)n2)N2CCN(C(=O)c3ccco3)CC2)cc1 |
| InChI | InChI=1S/C25H27N7O3S/c1-16-15-17(2)27-23(26-16)29-24(30-25(36)28-20-8-6-19(7-9-20)18(3)33)32-12-10-31(11-13-32)22(34)21-5-4-14-35-21/h4-9,14-15H,10-13H2,1-3H3,(H2,26,27,28,29,30,36) |
| InChIKey | WFVMXFYUQPUALG-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 115.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.60 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|