C22H29N7O2S — CID 17090943
(3Z)-1-cyclopentyl-3-[[(4,6-dimethylpyrimidin-2-yl)amino]-[4-(furan-2-carbonyl)piperazin-1-yl]methylidene]thiourea (PubChem CID 17090943) has the molecular formula C22H29N7O2S and a molecular weight of 455.59 g/mol. Its IUPAC name is (3Z)-1-cyclopentyl-3-[[(4,6-dimethylpyrimidin-2-yl)amino]-[4-(furan-2-carbonyl)piperazin-1-yl]methylidene]thiourea.
| Compound Name | (3Z)-1-cyclopentyl-3-[[(4,6-dimethylpyrimidin-2-yl)amino]-[4-(furan-2-carbonyl)piperazin-1-yl]methylidene]thiourea |
|---|---|
| PubChem CID | 17090943 |
| Molecular Formula | C22H29N7O2S |
| Molecular Weight | 455.59 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | (3Z)-1-cyclopentyl-3-[[(4,6-dimethylpyrimidin-2-yl)amino]-[4-(furan-2-carbonyl)piperazin-1-yl]methylidene]thiourea |
| SMILES | Cc1cc(C)nc(N/C(=N/C(=S)NC2CCCC2)N2CCN(C(=O)c3ccco3)CC2)n1 |
| InChI | InChI=1S/C22H29N7O2S/c1-15-14-16(2)24-20(23-15)26-21(27-22(32)25-17-6-3-4-7-17)29-11-9-28(10-12-29)19(30)18-8-5-13-31-18/h5,8,13-14,17H,3-4,6-7,9-12H2,1-2H3,(H2,23,24,25,26,27,32) |
| InChIKey | JXWOHZVICJZGLX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 98.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.59 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|