C24H25Cl2N7O — CID 135771565
1-(4-chlorophenyl)-3-[(Z)-C-[4-(4-chlorophenyl)piperazin-1-yl]-N-(4,6-dimethylpyrimidin-2-yl)carbonimidoyl]urea (PubChem CID 135771565) has the molecular formula C24H25Cl2N7O and a molecular weight of 498.42 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(Z)-C-[4-(4-chlorophenyl)piperazin-1-yl]-N-(4,6-dimethylpyrimidin-2-yl)carbonimidoyl]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[(Z)-C-[4-(4-chlorophenyl)piperazin-1-yl]-N-(4,6-dimethylpyrimidin-2-yl)carbonimidoyl]urea |
|---|---|
| PubChem CID | 135771565 |
| Molecular Formula | C24H25Cl2N7O |
| Molecular Weight | 498.42 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(Z)-C-[4-(4-chlorophenyl)piperazin-1-yl]-N-(4,6-dimethylpyrimidin-2-yl)carbonimidoyl]urea |
| SMILES | Cc1cc(C)nc(/N=C(/NC(=O)Nc2ccc(Cl)cc2)N2CCN(c3ccc(Cl)cc3)CC2)n1 |
| InChI | InChI=1S/C24H25Cl2N7O/c1-16-15-17(2)28-22(27-16)30-23(31-24(34)29-20-7-3-18(25)4-8-20)33-13-11-32(12-14-33)21-9-5-19(26)6-10-21/h3-10,15H,11-14H2,1-2H3,(H2,27,28,29,30,31,34) |
| InChIKey | BILUVOCXYFLREA-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.42 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|