C24H27N7O — CID 135610042
1-[(E)-N-(4,6-dimethylpyrimidin-2-yl)-C-(4-phenylpiperazin-1-yl)carbonimidoyl]-3-phenylurea (PubChem CID 135610042) has the molecular formula C24H27N7O and a molecular weight of 429.53 g/mol. Its IUPAC name is 1-[(E)-N-(4,6-dimethylpyrimidin-2-yl)-C-(4-phenylpiperazin-1-yl)carbonimidoyl]-3-phenylurea.
| Compound Name | 1-[(E)-N-(4,6-dimethylpyrimidin-2-yl)-C-(4-phenylpiperazin-1-yl)carbonimidoyl]-3-phenylurea |
|---|---|
| PubChem CID | 135610042 |
| Molecular Formula | C24H27N7O |
| Molecular Weight | 429.53 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | 1-[(E)-N-(4,6-dimethylpyrimidin-2-yl)-C-(4-phenylpiperazin-1-yl)carbonimidoyl]-3-phenylurea |
| SMILES | Cc1cc(C)nc(/N=C(\NC(=O)Nc2ccccc2)N2CCN(c3ccccc3)CC2)n1 |
| InChI | InChI=1S/C24H27N7O/c1-18-17-19(2)26-22(25-18)28-23(29-24(32)27-20-9-5-3-6-10-20)31-15-13-30(14-16-31)21-11-7-4-8-12-21/h3-12,17H,13-16H2,1-2H3,(H2,25,26,27,28,29,32) |
| InChIKey | TWWUSGHGZJZYJD-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.53 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|