C15H17N5O — CID 135641854
N-[(E)-N'-(4,6-dimethylpyrimidin-2-yl)-N-phenylcarbamimidoyl]acetamide (PubChem CID 135641854) has the molecular formula C15H17N5O and a molecular weight of 283.34 g/mol. Its IUPAC name is N-[(E)-N'-(4,6-dimethylpyrimidin-2-yl)-N-phenylcarbamimidoyl]acetamide.
| Compound Name | N-[(E)-N'-(4,6-dimethylpyrimidin-2-yl)-N-phenylcarbamimidoyl]acetamide |
|---|---|
| PubChem CID | 135641854 |
| Molecular Formula | C15H17N5O |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | N-[(E)-N'-(4,6-dimethylpyrimidin-2-yl)-N-phenylcarbamimidoyl]acetamide |
| SMILES | CC(=O)N/C(=N/c1nc(C)cc(C)n1)Nc1ccccc1 |
| InChI | InChI=1S/C15H17N5O/c1-10-9-11(2)17-14(16-10)20-15(18-12(3)21)19-13-7-5-4-6-8-13/h4-9H,1-3H3,(H2,16,17,18,19,20,21) |
| InChIKey | QPKCCCGTOSJYNJ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 79.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|