C30H31N5O2 — CID 135960927
(2S)-N-[(Z)-N'-(4,6-dimethylpyrimidin-2-yl)-N-(4-phenylmethoxyphenyl)carbamimidoyl]-2-phenylbutanamide (PubChem CID 135960927) has the molecular formula C30H31N5O2 and a molecular weight of 493.61 g/mol. Its IUPAC name is (2S)-N-[(Z)-N'-(4,6-dimethylpyrimidin-2-yl)-N-(4-phenylmethoxyphenyl)carbamimidoyl]-2-phenylbutanamide.
| Compound Name | (2S)-N-[(Z)-N'-(4,6-dimethylpyrimidin-2-yl)-N-(4-phenylmethoxyphenyl)carbamimidoyl]-2-phenylbutanamide |
|---|---|
| PubChem CID | 135960927 |
| Molecular Formula | C30H31N5O2 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.25 |
| IUPAC Name | (2S)-N-[(Z)-N'-(4,6-dimethylpyrimidin-2-yl)-N-(4-phenylmethoxyphenyl)carbamimidoyl]-2-phenylbutanamide |
| SMILES | CC[C@H](C(=O)N/C(=N\c1nc(C)cc(C)n1)Nc1ccc(OCc2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C30H31N5O2/c1-4-27(24-13-9-6-10-14-24)28(36)34-30(35-29-31-21(2)19-22(3)32-29)33-25-15-17-26(18-16-25)37-20-23-11-7-5-8-12-23/h5-19,27H,4,20H2,1-3H3,(H2,31,32,33,34,35,36)/t27-/m0/s1 |
| InChIKey | GWQIXCUTDMFXFZ-MHZLTWQESA-N |
| XLogP | 6.08 |
| TPSA | 88.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|