C27H24Cl2N6O2 — CID 135512957
1-(3-chlorophenyl)-3-[(Z)-N-[4-[(4-chlorophenyl)methoxy]phenyl]-N'-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]urea (PubChem CID 135512957) has the molecular formula C27H24Cl2N6O2 and a molecular weight of 535.44 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[(Z)-N-[4-[(4-chlorophenyl)methoxy]phenyl]-N'-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[(Z)-N-[4-[(4-chlorophenyl)methoxy]phenyl]-N'-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]urea |
|---|---|
| PubChem CID | 135512957 |
| Molecular Formula | C27H24Cl2N6O2 |
| Molecular Weight | 535.44 g/mol |
| Exact Mass | 534.13 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[(Z)-N-[4-[(4-chlorophenyl)methoxy]phenyl]-N'-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]urea |
| SMILES | Cc1cc(C)nc(/N=C(\NC(=O)Nc2cccc(Cl)c2)Nc2ccc(OCc3ccc(Cl)cc3)cc2)n1 |
| InChI | InChI=1S/C27H24Cl2N6O2/c1-17-14-18(2)31-25(30-17)34-26(35-27(36)33-23-5-3-4-21(29)15-23)32-22-10-12-24(13-11-22)37-16-19-6-8-20(28)9-7-19/h3-15H,16H2,1-2H3,(H3,30,31,32,33,34,35,36) |
| InChIKey | NJYFQQKRIHNTOX-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 100.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.44 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|