C22H22Cl2N6O2 — CID 135422816
1-(3,4-dichlorophenyl)-3-[N'-(4,6-dimethylpyrimidin-2-yl)-N-(4-ethoxyphenyl)carbamimidoyl]urea (PubChem CID 135422816) has the molecular formula C22H22Cl2N6O2 and a molecular weight of 473.36 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[N'-(4,6-dimethylpyrimidin-2-yl)-N-(4-ethoxyphenyl)carbamimidoyl]urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[N'-(4,6-dimethylpyrimidin-2-yl)-N-(4-ethoxyphenyl)carbamimidoyl]urea |
|---|---|
| PubChem CID | 135422816 |
| Molecular Formula | C22H22Cl2N6O2 |
| Molecular Weight | 473.36 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[N'-(4,6-dimethylpyrimidin-2-yl)-N-(4-ethoxyphenyl)carbamimidoyl]urea |
| SMILES | CCOc1ccc(NC(=Nc2nc(C)cc(C)n2)NC(=O)Nc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C22H22Cl2N6O2/c1-4-32-17-8-5-15(6-9-17)27-21(29-20-25-13(2)11-14(3)26-20)30-22(31)28-16-7-10-18(23)19(24)12-16/h5-12H,4H2,1-3H3,(H3,25,26,27,28,29,30,31) |
| InChIKey | VDTOPIWSEXONBB-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 100.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.36 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|