C22H22Cl2N6O — CID 135500429
1-(3,4-dichlorophenyl)-3-[N'-(4,6-dimethylpyrimidin-2-yl)-N-(4-ethylphenyl)carbamimidoyl]urea (PubChem CID 135500429) has the molecular formula C22H22Cl2N6O and a molecular weight of 457.37 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-[N'-(4,6-dimethylpyrimidin-2-yl)-N-(4-ethylphenyl)carbamimidoyl]urea.
| Compound Name | 1-(3,4-dichlorophenyl)-3-[N'-(4,6-dimethylpyrimidin-2-yl)-N-(4-ethylphenyl)carbamimidoyl]urea |
|---|---|
| PubChem CID | 135500429 |
| Molecular Formula | C22H22Cl2N6O |
| Molecular Weight | 457.37 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-[N'-(4,6-dimethylpyrimidin-2-yl)-N-(4-ethylphenyl)carbamimidoyl]urea |
| SMILES | CCc1ccc(NC(=Nc2nc(C)cc(C)n2)NC(=O)Nc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C22H22Cl2N6O/c1-4-15-5-7-16(8-6-15)27-21(29-20-25-13(2)11-14(3)26-20)30-22(31)28-17-9-10-18(23)19(24)12-17/h5-12H,4H2,1-3H3,(H3,25,26,27,28,29,30,31) |
| InChIKey | TXAGFWIPIBEGPE-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 91.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.37 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|