C20H15Cl2FN6O3 — CID 135632123
2-chloro-N-[(Z)-N-(3-chloro-4-fluorophenyl)-N'-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]-5-nitrobenzamide (PubChem CID 135632123) has the molecular formula C20H15Cl2FN6O3 and a molecular weight of 477.28 g/mol. Its IUPAC name is 2-chloro-N-[(Z)-N-(3-chloro-4-fluorophenyl)-N'-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]-5-nitrobenzamide.
| Compound Name | 2-chloro-N-[(Z)-N-(3-chloro-4-fluorophenyl)-N'-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 135632123 |
| Molecular Formula | C20H15Cl2FN6O3 |
| Molecular Weight | 477.28 g/mol |
| Exact Mass | 476.06 |
| IUPAC Name | 2-chloro-N-[(Z)-N-(3-chloro-4-fluorophenyl)-N'-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]-5-nitrobenzamide |
| SMILES | Cc1cc(C)nc(/N=C(\NC(=O)c2cc([N+](=O)[O-])ccc2Cl)Nc2ccc(F)c(Cl)c2)n1 |
| InChI | InChI=1S/C20H15Cl2FN6O3/c1-10-7-11(2)25-19(24-10)28-20(26-12-3-6-17(23)16(22)8-12)27-18(30)14-9-13(29(31)32)4-5-15(14)21/h3-9H,1-2H3,(H2,24,25,26,27,28,30) |
| InChIKey | XVYFUFAIYPYMCY-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 122.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.28 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|