C20H18Cl2N6O — CID 135643746
1-(2,4-dichlorophenyl)-3-[(E)-N'-(4,6-dimethylpyrimidin-2-yl)-N-phenylcarbamimidoyl]urea (PubChem CID 135643746) has the molecular formula C20H18Cl2N6O and a molecular weight of 429.31 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-[(E)-N'-(4,6-dimethylpyrimidin-2-yl)-N-phenylcarbamimidoyl]urea.
| Compound Name | 1-(2,4-dichlorophenyl)-3-[(E)-N'-(4,6-dimethylpyrimidin-2-yl)-N-phenylcarbamimidoyl]urea |
|---|---|
| PubChem CID | 135643746 |
| Molecular Formula | C20H18Cl2N6O |
| Molecular Weight | 429.31 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-[(E)-N'-(4,6-dimethylpyrimidin-2-yl)-N-phenylcarbamimidoyl]urea |
| SMILES | Cc1cc(C)nc(/N=C(/NC(=O)Nc2ccc(Cl)cc2Cl)Nc2ccccc2)n1 |
| InChI | InChI=1S/C20H18Cl2N6O/c1-12-10-13(2)24-18(23-12)27-19(25-15-6-4-3-5-7-15)28-20(29)26-17-9-8-14(21)11-16(17)22/h3-11H,1-2H3,(H3,23,24,25,26,27,28,29) |
| InChIKey | ZXXFTYWKPHPDFG-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 91.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.31 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|