C20H17Cl2N5O — CID 135516412
N-[(E)-N-(3,4-dichlorophenyl)-N'-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]benzamide (PubChem CID 135516412) has the molecular formula C20H17Cl2N5O and a molecular weight of 414.30 g/mol. Its IUPAC name is N-[(E)-N-(3,4-dichlorophenyl)-N'-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]benzamide.
| Compound Name | N-[(E)-N-(3,4-dichlorophenyl)-N'-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 135516412 |
| Molecular Formula | C20H17Cl2N5O |
| Molecular Weight | 414.30 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | N-[(E)-N-(3,4-dichlorophenyl)-N'-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]benzamide |
| SMILES | Cc1cc(C)nc(/N=C(/NC(=O)c2ccccc2)Nc2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C20H17Cl2N5O/c1-12-10-13(2)24-19(23-12)27-20(25-15-8-9-16(21)17(22)11-15)26-18(28)14-6-4-3-5-7-14/h3-11H,1-2H3,(H2,23,24,25,26,27,28) |
| InChIKey | LXQDEHSOTOFEEF-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 79.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.30 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|