C21H17ClF3N5O — CID 135500733
N-[(Z)-N-[2-chloro-5-(trifluoromethyl)phenyl]-N'-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]benzamide (PubChem CID 135500733) has the molecular formula C21H17ClF3N5O and a molecular weight of 447.85 g/mol. Its IUPAC name is N-[(Z)-N-[2-chloro-5-(trifluoromethyl)phenyl]-N'-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]benzamide.
| Compound Name | N-[(Z)-N-[2-chloro-5-(trifluoromethyl)phenyl]-N'-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 135500733 |
| Molecular Formula | C21H17ClF3N5O |
| Molecular Weight | 447.85 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | N-[(Z)-N-[2-chloro-5-(trifluoromethyl)phenyl]-N'-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]benzamide |
| SMILES | Cc1cc(C)nc(/N=C(\NC(=O)c2ccccc2)Nc2cc(C(F)(F)F)ccc2Cl)n1 |
| InChI | InChI=1S/C21H17ClF3N5O/c1-12-10-13(2)27-19(26-12)30-20(29-18(31)14-6-4-3-5-7-14)28-17-11-15(21(23,24)25)8-9-16(17)22/h3-11H,1-2H3,(H2,26,27,28,29,30,31) |
| InChIKey | NCIMNZMGIASSGZ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 79.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.85 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|