C22H23N5O — CID 135492102
N-[N-(3,4-dimethylphenyl)-N'-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]benzamide (PubChem CID 135492102) has the molecular formula C22H23N5O and a molecular weight of 373.46 g/mol. Its IUPAC name is N-[N-(3,4-dimethylphenyl)-N'-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]benzamide.
| Compound Name | N-[N-(3,4-dimethylphenyl)-N'-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 135492102 |
| Molecular Formula | C22H23N5O |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | N-[N-(3,4-dimethylphenyl)-N'-(4,6-dimethylpyrimidin-2-yl)carbamimidoyl]benzamide |
| SMILES | Cc1cc(C)nc(N=C(NC(=O)c2ccccc2)Nc2ccc(C)c(C)c2)n1 |
| InChI | InChI=1S/C22H23N5O/c1-14-10-11-19(12-15(14)2)25-22(26-20(28)18-8-6-5-7-9-18)27-21-23-16(3)13-17(4)24-21/h5-13H,1-4H3,(H2,23,24,25,26,27,28) |
| InChIKey | DJHYHFGZSPJZLO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 79.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|